M4100235
Mefexamidehydrochloride , 98% , 1227-61-8
Synonym(s):
p-Methoxyphenoxyacetic acid 2-(diethylamino)ethylamide
CAS NO.：1227-61-8
Empirical Formula: C15H24N2O3
Molecular Weight: 280.36
MDL number: MFCD00079457
EINECS: 214-963-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB364.80 | In Stock |
|
| 500mg | RMB1168.00 | In Stock |
|
| 1g | RMB2102.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 423.08°C (rough estimate) |
| Density | 1.0586 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C15H24N2O3.ClH/c1-4-17(5-2)11-10-16-15(18)12-20-14-8-6-13(19-3)7-9-14;/h6-9H,4-5,10-12H2,1-3H3,(H,16,18);1H |
| InChIKey | AXBHPHPHZHAOAK-UHFFFAOYSA-N |
| SMILES | Cl.CCN(CC)CCNC(=O)COc1ccc(OC)cc1 |
Description and Uses
CNS stimulant
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | AB7175000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |