PRODUCT Properties
| Melting point: | 40-42°C |
| Boiling point: | 102.98°C (rough estimate) |
| Density | 1.2076 (rough estimate) |
| refractive index | 1.3720 (estimate) |
| solubility | sol H2O; sol most organic solvents, e.g. ether, CH2Cl2, THF, acetone, etc. |
| InChI | InChI=1S/C3H4O3/c1-6-3(5)2-4/h2H,1H3 |
| InChIKey | KFKXSMSQHIOMSO-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C=O |
| CAS DataBase Reference | 922-68-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl glyoxylate(922-68-9) |
| EPA Substance Registry System | Acetic acid, oxo-, methyl ester (922-68-9) |
Description and Uses
Methyl Glyoxylate is a useful compound for preparation of pyridine and quinoline derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS02 |
| Signal word | Warning |
| Hazard statements | H315-H226-H335-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |







