PRODUCT Properties
| Melting point: | ~190 °C (dec.) |
| Boiling point: | 298.46°C (rough estimate) |
| Density | 1.2435 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Heated, Sonicated) |
| pka | 9.57±0.10(Predicted) |
| form | Solid |
| color | Pale Beige to Dark Brown |
| Merck | 6695 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2 |
| InChIKey | SFLSHLFXELFNJZ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(O)CN)C=C1O |
| CAS DataBase Reference | 138-65-8 |
Description and Uses
(±)-Noradrenaline is the neurotransmitter at most sympathetic neuroeffector junctions and has pharmacologic effects on both α1 and β1 adrenoceptors.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| Hazard Codes | T+ |
| Risk Statements | 28-41-26/27/28 |
| Safety Statements | 28-36/37/39-45-36/37 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | DN6300000 |
| F | 8-10-23 |
| HazardClass | IRRITANT |
| Toxicity | LD50 ivn-rat: 130 mg/kg JPETAB 95,502,49 |
