PRODUCT Properties
Melting point: | ~190 °C (dec.) |
Boiling point: | 298.46°C (rough estimate) |
Density | 1.2435 (rough estimate) |
refractive index | 1.5100 (estimate) |
storage temp. | 2-8°C |
solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Heated, Sonicated) |
pka | 9.57±0.10(Predicted) |
form | Solid |
color | Pale Beige to Dark Brown |
Merck | 6695 |
Stability: | Hygroscopic |
InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2 |
InChIKey | SFLSHLFXELFNJZ-UHFFFAOYSA-N |
SMILES | C1(O)=CC=C(C(O)CN)C=C1O |
CAS DataBase Reference | 138-65-8 |
Description and Uses
(±)-Noradrenaline is the neurotransmitter at most sympathetic neuroeffector junctions and has pharmacologic effects on both α1 and β1 adrenoceptors.
Safety
Symbol(GHS) | ![]() GHS06 |
Signal word | Danger |
Hazard statements | H301 |
Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
Hazard Codes | T+ |
Risk Statements | 28-41-26/27/28 |
Safety Statements | 28-36/37/39-45-36/37 |
RIDADR | UN 2811 |
WGK Germany | 3 |
RTECS | DN6300000 |
F | 8-10-23 |
HazardClass | IRRITANT |
Toxicity | LD50 ivn-rat: 130 mg/kg JPETAB 95,502,49 |