PRODUCT Properties
| Melting point: | 210 °C |
| Boiling point: | 586.0±50.0 °C(Predicted) |
| Density | 1.146±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | acetone: 1%, turbid, blue to very deep blue |
| pka | 5.51±0.20(Predicted) |
| form | powder |
| Colour Index | 61555 |
| λmax | 596 nm 644 nm (2nd) |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C24H30N2O2/c1-3-5-9-15-25-19-13-14-20(26-16-10-6-4-2)22-21(19)23(27)17-11-7-8-12-18(17)24(22)28/h7-8,11-14,25-26H,3-6,9-10,15-16H2,1-2H3 |
| InChIKey | RHGBRYSELHPAFL-UHFFFAOYSA-N |
| SMILES | CCCCCNc1ccc(NCCCCC)c2C(=O)c3ccccc3C(=O)c12 |
| CAS DataBase Reference | 2646-15-3 |
| EPA Substance Registry System | 9,10-Anthracenedione, 1,4-bis(pentylamino)- (2646-15-3) |
Description and Uses
Oil Blue N stains fatty substances dark blue In animal tissues when supersaturated solutions in dilute isopropanol are used. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
