A3477712
1,4-Diaminoanthraquinone , >90.0%(N) , 128-95-0
Synonym(s):
1,4-Diamino-9,10-anthracenedione;1,4-Diamino-9,10-anthraquinone;1,4-Diaminoanthraquinone
CAS NO.:128-95-0
Empirical Formula: C14H10N2O2
Molecular Weight: 238.24
MDL number: MFCD00001224
EINECS: 204-922-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB84.80 | In Stock |
|
| 100g | RMB212.80 | In Stock |
|
| 500G | RMB680.80 | In Stock |
|
| 2.5kg | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265-269 °C(lit.) |
| Boiling point: | 380.84°C (rough estimate) |
| Density | 1.44 g/cm3 (20℃) |
| vapor pressure | <1 hPa (25 °C) |
| refractive index | 1.6500 (estimate) |
| Flash point: | 340 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in benzene, pyridine, the difficulties, slightly soluble in hot aniline acetate, ethanol. |
| pka | 1.17±0.20(Predicted) |
| form | Solid |
| color | Dark Violet to Black |
| PH | 7 (H2O, 20℃) |
| Water Solubility | 228.7ug/L(25 ºC) |
| BRN | 2216556 |
| Stability: | Light Sensitive |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | 1,4-Diamino anthraquinone (128-95-0) |
| InChI | 1S/C14H10N2O2/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6H,15-16H2 |
| InChIKey | FBMQNRKSAWNXBT-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N)c2C(=O)c3ccccc3C(=O)c12 |
| LogP | 3.000 |
| CAS DataBase Reference | 128-95-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Diaminoanthraquinone(128-95-0) |
| EPA Substance Registry System | 1,4-Diaminoanthraquinone (128-95-0) |
Description and Uses
As an anthraquinone derivative, 1,4-Diamino anthraquinone is a potent and selective protein kinase CK1 delta inhibitor. Studies suggest that it has potential solar cell applications. 1,4-Diamino anthraquinone can be used in studies as a potential competitive non-peptidic inhibitor of HIV-1 proteinase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22 |
| Safety Statements | 22-36/37 |
| WGK Germany | 2 |
| RTECS | CB6300000 |
| Autoignition Temperature | >400 °C |
| TSCA | TSCA listed |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
| Toxicity | LD50 orally in Rabbit: 5790 mg/kg |





