PRODUCT Properties
| Melting point: | 50-53 °C |
| Boiling point: | 275.5±28.0 °C(Predicted) |
| Density | 1.213±0.06 g/cm3(Predicted) |
| storage temp. | Amber Vial, -86°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.62±0.10(Predicted) |
| color | White to Light Yellow |
| Stability: | Light Sensitive, Temperature Sensitive |
| InChI | InChI=1S/C8H8O2/c1-2-6-3-4-7(9)8(10)5-6/h2-5,9-10H,1H2 |
| InChIKey | FBTSUTGMWBDAAC-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C=C)C=C1O |
Description and Uses
A metabolite of Styrene (S687790).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
