PRODUCT Properties
| Melting point: | 32.5-37.5 °C(lit.) |
| Boiling point: | 151 °C(Press: 0.8 Torr) |
| Density | 1.21 g/mL at 25 °C(lit.) |
| vapor pressure | 0.009Pa at 25℃ |
| Flash point: | 230 °F |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | solid |
| Water Solubility | 1.56g/L at 20℃ |
| InChI | InChI=1S/C13H13O3P/c1-17(14,15-12-8-4-2-5-9-12)16-13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | HPUPGAFDTWIMBR-UHFFFAOYSA-N |
| SMILES | P(C)(=O)(OC1=CC=CC=C1)OC1=CC=CC=C1 |
| LogP | 2.8 at 30℃ |
| CAS DataBase Reference | 7526-26-3 |
| EPA Substance Registry System | Phosphonic acid, methyl-, diphenyl ester (7526-26-3) |
Description and Uses
Diphenyl Methylphosphonate is an intermediate in the synthesis of organophosphorus compounds as potential pesticides.
Safety
| Symbol(GHS) | ![]() ![]() GHS09,GHS06 |
| Signal word | Danger |
| Hazard statements | H411-H301-H311 |
| Precautionary statements | P280-P302+P352-P312-P322-P361-P363-P405-P501-P264-P270-P301+P310-P321-P330-P405-P501 |
| WGK Germany | 3 |
| RTECS | SZ9127500 |
| TSCA | TSCA listed |





