M4297853
Ethylbeta-carboline-3-carboxylate(beta-CCE) , 97% , 74214-62-3
Synonym(s):
β-CCE;Ethyl 9H-pyrido[3,4-b]indole-3-carboxylate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-230 °C (lit.) |
| Boiling point: | 470.9±25.0 °C(Predicted) |
| Density | 1.308±0.06 g/cm3(Predicted) |
| solubility | DMSO (Slightly) |
| form | Solid |
| pka | 14.49±0.40(Predicted) |
| color | Pale Beige to Light Brown |
| Merck | 13,3814 |
| InChI | 1S/C14H12N2O2/c1-2-18-14(17)12-7-10-9-5-3-4-6-11(9)16-13(10)8-15-12/h3-8,16H,2H2,1H3 |
| InChIKey | KOVRZNUMIKACTB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2c(cn1)[nH]c3ccccc23 |
Description and Uses
Ethyl b-Carboline-3-carboxylate (b-CCE) is an inverse agonist of benzodiazepine activity. Negative modulator at benzodiazepine sites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | RN7092000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






