M4322153
gossypinfromhibiscusvitifolius*flowers , 90% , 652-78-8
Synonym(s):
2-(3,4-Dihydroxyphenyl)-8-(β-D-glucopyranosyloxy)-3,5,7-trihydroxy- 4H-1-benzopyran-4-one;3,3′,4′,5,7,8-Hexahydroxyflavone 8-glucoside;Gossypetin 8-glucoside
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-230°C |
| Boiling point: | 886.0±65.0 °C(Predicted) |
| Density | 1.883±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -20°C |
| solubility | DMSO: soluble15mg/mL, clear |
| form | powder |
| pka | 5.70±0.40(Predicted) |
| color | light yellow to dark green-yellow |
| Major Application | food and beverages |
| InChIKey | SJRXVLUZMMDCNG-KKPQBLLMSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2c(O)cc(O)c3C(=O)C(O)=C(Oc23)c4ccc(O)c(O)c4)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -1.320 (est) |
Description and Uses
antiinflammatory, antiangiogenesis, antineoplastic, inhibits NF-kB cell response
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-62-37/38-36-22 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| RTECS | DJ3009900 |
| HS Code | 2938909090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






