M4327353
TRIBUTYL(3-METHYL-2-BUTENYL)TIN , 90% , 53911-92-5
CAS NO.：53911-92-5
Empirical Formula: C17H36Sn
Molecular Weight: 359.18
MDL number: MFCD01863649
EINECS: 624-983-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB516.00 | In Stock |
|
| 5g | RMB1807.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 283 °C(lit.) |
| Density | 1.069 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Refrigerator (+4°C) |
| form | Liquid |
| Specific Gravity | 1.069 |
| color | Clear colorless |
| Water Solubility | Immiscible with water. |
| BRN | 3588742 |
| InChI | 1S/C5H9.3C4H9.Sn/c1-4-5(2)3;3*1-3-4-2;/h4H,1H2,2-3H3;3*1,3-4H2,2H3; |
| InChIKey | XEFRYQPTIWSVGI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)C\C=C(\C)C |
Description and Uses
Tri-n-butyl(3-methyl-2-butenyl)tin is used in prenylation of ethyl propiolate. It is also involved in chemical research.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H400-H301-H312-H315-H319-H372-H410 |
| Precautionary statements | P273-P280-P301+P310-P305+P351+P338-P314-P501-P260-P301+P310a-P405-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29312000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
