M4334353
7-Hydroxyquetiapinesolution , 1.0mg/mLinmethanol,ampuleof1mL,certifiedreferencematerial,Cerilliant? , 139079-39-3
CAS NO.:139079-39-3
Empirical Formula: C21H25N3O3S
Molecular Weight: 399.51
MDL number: MFCD09260019
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB2482.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-60°C |
| Boiling point: | 612.4±65.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| Flash point: | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 11.18±0.20(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Stability: | Hygroscopic |
| Major Application | clinical testing |
| InChI | 1S/C21H25N3O3S/c25-12-14-27-13-11-23-7-9-24(10-8-23)21-17-3-1-2-4-19(17)28-20-15-16(26)5-6-18(20)22-21/h1-6,15,25-26H,7-14H2 |
| InChIKey | VEGVCHRFYPFJFO-UHFFFAOYSA-N |
| SMILES | OCCOCCN1CCN(C2=NC(C=CC(O)=C3)=C3SC4=C2C=CC=C4)CC1 |
| CAS DataBase Reference | 139079-39-3 |
Description and Uses
7-HYDROXY QUETIAPINE is a metabolite of Quetiapine, a Benzothiazepine with mixed serotonin and dopamine receptor antagonistic properties used as an antipsychotic
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |








