PRODUCT Properties
| Melting point: | 46-48 °C (lit.) |
| Boiling point: | 96-97 °C/0.7 mmHg (lit.) |
| Density | 1.5278 (estimate) |
| Stability: | Stable, but hydrolyzes in water to generate acidic gas which can react with metals (and thereby generate flammable hydrogen gas). Incompatible with water, alcohols, strong bases, oxidizing agents. |
| InChI | 1S/C7H4ClFO3S/c8-7(10)5-1-3-6(4-2-5)13(9,11)12/h1-4H |
| InChIKey | JMTAYFNTRRLWQG-UHFFFAOYSA-N |
| SMILES | FS(=O)(=O)c1ccc(cc1)C(Cl)=O |
Description and Uses
4-(Fluorosulfonyl)benzoyl chloride was used as reagent in the synthesis of irreversible adenosine A1 antagonist 8-cyclopentyl-3-N-[3-((3-(4-fluorosulphonyl)benzoyl)-oxy)-propyl]-1-N-propyl-xanthine.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314-H335 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36/37-22 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B STOT SE 3 |







