PRODUCT Properties
| Melting point: | 138℃ |
| Boiling point: | 400.55°C (rough estimate) |
| Density | 1.01 |
| refractive index | 1.6360 (estimate) |
| pka | 10.12±0.50(Predicted) |
| Colour Index | 41000B |
| BRN | 2215338 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C17H21N3/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4/h5-12,18H,1-4H3 |
| InChIKey | JPIYZTWMUGTEHX-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)C(=N)c2ccc(cc2)N(C)C |
| CAS DataBase Reference | 492-80-8(CAS DataBase Reference) |
| IARC | 2B (Vol. 1, Sup 7, 99, 100F) 2012 |
| EPA Substance Registry System | Auramine (492-80-8) |
Description and Uses
Auramine is a yellow crystalline powder or flaky material. Molecular weight= 267.4; Freezing/Meltingpoint=136℃. Hazard Identification (based on NFPA-704M Rating System): Health 3, Flammability 1, Reactivity 0;(hydrochloride) Health 3, Flammability 0, Reactivity 0.Insoluble in water.
Yellow dye for paper, textiles, leather; antisep- tic; fungicide.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H351-H411 |
| Precautionary statements | P202-P264-P273-P301+P312-P305+P351+P338-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-40-51/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | BY3500000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 2 Eye Irrit. 2 |
| Hazardous Substances Data | 492-80-8(Hazardous Substances Data) |
