M4467353
TN-16 , >98%(LC&N) , 33016-12-5
Synonym(s):
3-[1-(Phenylamino)ethylidene]-5-(phenylmethyl)-2,4-pyrrolidinedione;NSC 239274
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB566.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182～185℃ |
| Boiling point: | 532.7±50.0 °C(Predicted) |
| Density | 1.249±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥17mg/mL |
| form | powder |
| pka | 10.53±0.40(Predicted) |
| color | white to tan |
| InChI | 1S/C19H18N2O2/c1-13(20-15-10-6-3-7-11-15)17-18(22)16(21-19(17)23)12-14-8-4-2-5-9-14/h2-11,16,20H,12H2,1H3,(H,21,23)/b17-13- |
| InChIKey | KWSXUGYAGMSUTN-LGMDPLHJSA-N |
| SMILES | C\C(Nc1ccccc1)=C2\C(=O)NC(Cc3ccccc3)C2=O |
Description and Uses
TN-16 is an antitumor drug that blocks microtubule assembly. Tubulin inhibitor.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H400 |
| Precautionary statements | P273-P280-P302+P352 |
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Skin Sens. 1 |
