M4493353
N-(2-Hydroxyethyl)isonicotinamidenitricester , BPReferenceStandard , 65141-47-1
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1849.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109-111°C |
| Boiling point: | 456.7±25.0 °C(Predicted) |
| Density | 1.331±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Acetone (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 12.38±0.46(Predicted) |
| color | Pale Yellow to Pale Beige |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C8H9N3O4/c12-8(7-1-3-9-4-2-7)10-5-6-15-11(13)14/h1-4H,5-6H2,(H,10,12) |
| InChIKey | VZCYAIHIDPPQHC-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])OCCNC(=O)c1ccncc1 |
Description and Uses
A positional isomeric impurity of the antianginal Nicorandil (N398500).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| WGK Germany | WGK 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
