M4533453
6-Azido-6-deoxy-D-glucose , 95% , 20847-05-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB3364.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130 °C |
| storage temp. | 2-8°C |
| form | powder |
| color | Light yellow to yellow |
| optical activity | [α]/D +59.0±3.0°, c = 0.2 in H2O |
| BRN | 4906473 |
| InChI | 1S/C6H11N3O5/c7-9-8-1-2-3(10)4(11)5(12)6(13)14-2/h2-6,10-13H,1H2/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | CMLRUUHRGSJVMD-GASJEMHNSA-N |
| SMILES | OC1O[C@H](CN=[N+]=[N-])[C@@H](O)[C@H](O)[C@H]1O |
Description and Uses
6-Azido-6-deoxy-D-galactose is a new selective metabolic chemical reporter (MCR) for labeling O-?GlcNAc-?modified proteins in cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 2940000080 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







