M4541853
N-Methyl-p-tyramine , 98% , 370-98-9
CAS NO.:370-98-9
Empirical Formula: C9H13NO
Molecular Weight: 151.21
MDL number: MFCD00870493
EINECS: 206-731-3
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB252.00 | In Stock |
|
| 50mg | RMB630.40 | In Stock |
|
| 250mg | RMB1108.80 | In Stock |
|
| 1g | RMB3160.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130~131℃ |
| Boiling point: | 270.9±15.0 °C(Predicted) |
| Density | 1.035±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.86±0.15(Predicted) |
| color | Pale Beige to Light Beige |
| InChI | InChI=1S/C9H13NO/c1-10-7-6-8-2-4-9(11)5-3-8/h2-5,10-11H,6-7H2,1H3 |
| InChIKey | AXVZFRBSCNEKPQ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCNC)C=C1 |
Description and Uses
N-Methyltyramine is a protoalkaloid that can be isolated from various plant species. N-Methyltyramine is an α2-adrenoreceptor antagonist. N-Methyltyramine enhances appetite and digestion of foods by stimulating gastrin and pancreatic secretions. N-Methyltyramine can relax mouse small intestinal smooth muscle and inhibits small intestinal propulsion[1][2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| HS Code | 2922290090 |






