PRODUCT Properties
| Melting point: | 119-121 °C |
| Boiling point: | 140-180 °C(Press: 0.01 Torr) |
| Density | 1.5756 (estimate) |
| pka | 6.16±0.33(Predicted) |
| Henry's Law Constant | 1.4×100 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| InChI | InChI=1S/C7H4Cl4O2/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h12H,1H3 |
| InChIKey | YZZVKLJKDFFSFL-UHFFFAOYSA-N |
| SMILES | C1(O)=C(OC)C(Cl)=C(Cl)C(Cl)=C1Cl |
| EPA Substance Registry System | Tetrachloroguaiacol (2539-17-5) |
Description and Uses
Tetrachloroguaiacol is a product formed from the degradation pathway of pentachlorophenol (PCP) in the fungal community. A chlorophenolic detected in wastewater.





