M4612053
Dhurrin , 95% , 499-20-7
Synonym(s):
(S)-(β-D -Glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile;(S)-4-Hydroxymandelonitrile β-D -glucoside
CAS NO.：499-20-7
Empirical Formula: C14H17NO7
Molecular Weight: 311.29
MDL number: MFCD00075955
EINECS: 207-878-6
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB2169.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200°C (dec.) |
| alpha | D20 -65° (alc) |
| Boiling point: | 586.7±50.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| storage temp. | room temp |
| pka | 9.19±0.26(Predicted) |
| form | powder or crystals |
| color | white to light brown |
| InChI | 1S/C14H17NO7/c15-5-9(7-1-3-8(17)4-2-7)21-14-13(20)12(19)11(18)10(6-16)22-14/h1-4,9-14,16-20H,6H2/t9-,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | NVLTYOJHPBMILU-YOVYLDAJSA-N |
| SMILES | OC[C@H]1O[C@@H](O[C@H](C#N)c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O || OC[C@H]1O[C@@H](O[C@H](C#N)c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -1.650 (est) |
Description and Uses
Dhurrin is a cyanogenic glucoside produced by sorghum and is considered a natural defense compound producing hydrogen cyanide to deter animal herbivores.
