PRODUCT Properties
| Boiling point: | 86°C/ 1 mm |
| Density | 1.0874 |
| refractive index | 1.6180 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO: 5mg/mL |
| form | Oil |
| pka | -1.59±0.50(Predicted) |
| color | Yellow oil |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H10N2O/c1-2-10(9-11)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | WXRXVZXYLBWKRG-UHFFFAOYSA-N |
| SMILES | C1(N(CC)N=O)=CC=CC=C1 |
| EPA Substance Registry System | N-Nitroso-N-ethylaniline (612-64-6) |
Description and Uses
N-Nitroso-N-ethylaniline is a member of the N-nitrosamine class of compounds, which are classified as carcinogens by the Environmental Protection Agency.1 However, N-nitroso-N-ethylaniline is non-carcinogenic in a survival assay using 2FR450 Rauscher leukemia virus-infected rat embryo cultures.2 It is a synthetic intermediate in the synthesis of 3-amino-4-hydrazine-cyclobut-3-ene-1,2-diones as antagonists of chemokine (C-X-C motif) receptor 2 (CXCR2).3WARNING This product is not for human or veterinary use.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H350 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| Safety Statements | 24/25 |
| RIDADR | 2810 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214200 |
| Toxicity | LD50 orl-rat: 180 mg/kg VOONAW 14(3),37,68 |




