PRODUCT Properties
| Melting point: | 189° (uncorr), 193° (corr) |
| Boiling point: | 632.3±55.0 °C(Predicted) |
| Density | 1.258±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder |
| pka | 7.00±0.40(Predicted) |
| color | Yellow |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | 1S/C25H24O5/c1-14(2)5-10-17-21(27)20-22(28)19(15-6-8-16(26)9-7-15)13-29-24(20)18-11-12-25(3,4)30-23(17)18/h5-9,11-13,26-27H,10H2,1-4H3 |
| InChIKey | DCTLJGWMHPGCOS-UHFFFAOYSA-N |
| SMILES | C\C(C)=C\Cc1c(O)c2C(=O)C(=COc2c3C=CC(C)(C)Oc13)c4ccc(O)cc4 |
Description and Uses
Osajin is an inhibitor of carbonic anhydrase I and II isoenzymes for therapeutic application such as the treatment of glaucoma.
