M4662553
Di-n-pentylPhthalate-3?4?5?6-d4 , analyticalstandard , 358730-89-9
Synonym(s):
Di-n-pentyl phthalate-d4
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB543.20 | In Stock |
|
| 10mg | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 342 °C |
| Density | 1.036 g/mL at 25 °C |
| Flash point: | 118 °C |
| solubility | Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless to light yellow |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C18H26O4/c1-3-5-9-13-21-17(19)15-11-7-8-12-16(15)18(20)22-14-10-6-4-2/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3/i7D,8D,11D,12D |
| InChIKey | IPKKHRVROFYTEK-CXRURWBMSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)OCCCCC)c(c1[2H])C(=O)OCCCCC |
Description and Uses
Amyl Phthalate-d4 is the isotope labelled analog of Amyl Phthalate. Amyl Phthalate, is a Phthalate esters (PEs) acting as a plasticizer compounds that are widely used for many consumer product applications. It is also known to induce male fetal endocrine toxicity and postnatal reproductive malformations by disrupting androgen production during the sexual differentiation period of development.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| Hazard Codes | T,N |
| Risk Statements | 60-61-50 |
| Safety Statements | 53-45-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Repr. 1B |








