M4676553
2,3,3,3-Tetrafluoro-2-(1,1,2,3,3,3-hexafluoro-2-(1,1,2,3,3,3-hexafluoro-2-(trifluoromethoxy)propoxy)propoxy)propanoicacid , 95% , 65294-16-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 329.3±42.0 °C(Predicted) |
| Density | 1.808±0.06 g/cm3(Predicted) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | liquid |
| pka | -1.25±0.10(Predicted) |
| color | Clear |
| InChI | InChI=1S/C12HF23O5/c13-2(1(36)37,6(18,19)20)38-11(32,33)4(16,8(24,25)26)40-12(34,35)5(17,9(27,28)29)39-10(30,31)3(14,15)7(21,22)23/h(H,36,37) |
| InChIKey | HPNULWLLEOKCID-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| EPA Substance Registry System | Perfluoro-(2,5,8-trimethyl-3,6,9-trioxadodecanoic)acid (65294-16-8) |
Description and Uses
Perfluoro-(2,5,8-trimethyl-3,6,9-trioxadodecanoic)acid (CAS# 65294-16-8) is a CO2-soluble fluoropolymer used frequently as a surfactant, such as for CO2 drying of aqueous photoresists. Perfluoro-(2,5,8-trimethyl-3,6,9-trioxadodecanoic)acid is used as a building block for fluorine-containing emulsifiers for oil-in-water emulsions.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P280 |
| HS Code | 2918999090 |





![2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]propan-1-ol](https://img.chemicalbook.com/CAS/GIF/14620-81-6.gif)
![[2-(2-Methoxyethoxy)ethoxy]acetic Acid](https://img.chemicalbook.com/CAS/GIF/16024-58-1.gif)