M4677553
Methyl2-chloro-9-hydroxy-9H-fluorene-9-carboxylate , 98% , 2536-31-4
Synonym(s):
Methyl 2-chloro-9-hydroxyfluorene-9-carboxylate
CAS NO.：2536-31-4
Empirical Formula: C15H11ClO3
Molecular Weight: 274.7
MDL number: MFCD00055339
EINECS: 219-800-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB851.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152°C |
| Boiling point: | 385.02°C (rough estimate) |
| Density | 1.2272 (rough estimate) |
| refractive index | 1.4585 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 10.87±0.20(Predicted) |
| color | Pale Yellow |
| Water Solubility | 18mg/L(20 ºC) |
| BRN | 2871254 |
| InChI | InChI=1S/C15H11ClO3/c1-19-14(17)15(18)12-5-3-2-4-10(12)11-7-6-9(16)8-13(11)15/h2-8,18H,1H3 |
| InChIKey | LINPVWIEWJTEEJ-UHFFFAOYSA-N |
| SMILES | C1(O)(C(OC)=O)C2=C(C=CC=C2)C2=C1C=C(Cl)C=C2 |
| CAS DataBase Reference | 2536-31-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Chlorflurecol methyl ester(2536-31-4) |
| EPA Substance Registry System | Chlorflurenol-methyl (2536-31-4) |
Description and Uses
Chlorflurenol-methyl is an auxin polar transport inhibitor that effects elongation growth of the excised fourth internode of tulips. Chlorflurenol-methyl is a pesticide.
