![4-Methyl-7-[(2S,3S,4R,5S,6S)-3,4,5-Trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-chromen-2-one](https://img.chemicalbook.com/CAS/GIF/54322-38-2.gif)
M4702853
4-Methyl-7-[(2S,3S,4R,5S,6S)-3,4,5-Trihydroxy-6-methyl-tetrahydropyran-2-yl]oxy-chromen-2-one , 95% , 54322-38-2
Synonym(s):
4-Methylumbelliferyl alpha-L-fucopyranoside
CAS NO.：54322-38-2
Empirical Formula: C16H18O7
Molecular Weight: 322.31
MDL number: MFCD00051218
EINECS: 259-098-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB8230.40 | In Stock |
|
| 500mg | RMB13696.00 | In Stock |
|
| 1g | RMB22822.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-232 °C |
| Boiling point: | 565.9±50.0 °C(Predicted) |
| Density | 1.441±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 25 mg/mL, clear, colorless |
| pka | 12.86±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 8160514 |
| Stability: | Light Sensitive |
| InChI | 1S/C16H18O7/c1-7-5-12(17)23-11-6-9(3-4-10(7)11)22-16-15(20)14(19)13(18)8(2)21-16/h3-6,8,13-16,18-20H,1-2H3/t8-,13+,14+,15-,16-/m0/s1 |
| InChIKey | CQKHENXHLAUMBH-CRLRYRHBSA-N |
| SMILES | C[C@@H]1O[C@@H](Oc2ccc3C(C)=CC(=O)Oc3c2)[C@@H](O)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 54322-38-2(CAS DataBase Reference) |
Description and Uses
4-Methylumbelliferyl a-L-Fucopyranoside can be used as a biological indicator of sterilization.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
