PRODUCT Properties
| Melting point: | 42 °C |
| Boiling point: | 106 °C |
| Density | 1.590±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.84±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C11H7F17O/c12-4(13,2-1-3-29)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h29H,1-3H2 |
| InChIKey | FQTWAKFTSLUFFS-UHFFFAOYSA-N |
| SMILES | C(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 1651-41-8(CAS DataBase Reference) |
| EPA Substance Registry System | 3-(Perfluorooctyl)propanol (1651-41-8) |
Description and Uses
3-(Perfluorooctyl)propan-1-olis is used in preparation of fluoroalkyl vinyl ether by reaction of fluorinated alcohol with divinyl ether and/or trivinyl ether.
Safety
| Hazard Codes | Xi |
| Hazard Note | Irritant |
