PRODUCT Properties
| Melting point: | 77-79 °C(Solv: ligroine (8032-32-4)) |
| Boiling point: | 296.7±15.0 °C(Predicted) |
| Density | 1.518±0.06 g/cm3(Predicted) |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C9H8BrClO/c1-6(10)9(12)7-2-4-8(11)5-3-7/h2-6H,1H3 |
| InChIKey | SAKMPXRILWVZEG-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1)(=O)C(Br)C |
Description and Uses
2-bromo-4-chloropropiophenone can be used as an intermediate in organic synthesis, mainly used in laboratory research and development and chemical production processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H335-H302-H315-H312-H319 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P280-P302+P352-P312-P322-P363-P501 |
| HS Code | 2914790090 |






