![(R)-2-(N-((2''-(1H-Tetrazol-5-yl)-[1,1''-biphenyl]-4-yl)methyl)pentanamido)-3-methylbutanoicacid](https://img.chemicalbook.com/CAS/GIF/137862-87-4.gif)
M4746553
(R)-2-(N-((2''-(1H-Tetrazol-5-yl)-[1,1''-biphenyl]-4-yl)methyl)pentanamido)-3-methylbutanoicacid , 95% , 137862-87-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1514.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-110°C |
| Boiling point: | 684.9±65.0 °C(Predicted) |
| Density | 1.212±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.56±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | ACWBQPMHZXGDFX-JOCHJYFZSA-N |
| SMILES | CCCCC(=O)N(Cc1ccc(cc1)-c2ccccc2-c3nnn[nH]3)[C@H](C(C)C)C(O)=O |
Description and Uses
ent-Valsartan is the (R)-enantiomer of Valsartan
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| target organs | Central nervous system |
| WGK Germany | WGK 3 |
| HS Code | 2933997500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 STOT SE 3 |
![5-(4'-methyl-[1,1'-biphenyl]-2-yl)-1H-tetrazole](https://img.chemicalbook.com/CAS/GIF/120568-11-8.gif)
