M4780753
(-)-Isoproterenolhydrochloride , 98% , 5984-95-2
Synonym(s):
(−)-Isoprenaline hydrochloride;(−)-N-Isopropyl-L -noradrenaline hydrochloride;(R)-3,4-Dihydroxy-α-(isopropylaminomethyl)benzyl alcohol hydrochloride
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1036.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175 °C (dec.)(lit.) |
| storage temp. | −20°C |
| solubility | soluble (50 mg/ml: H2O) |
| form | Solid |
| color | White to off-white |
| Water Solubility | soluble (50 mg/ml: H2O) |
| BRN | 6077193 |
| InChI | InChI=1S/C11H17NO3.ClH/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8;/h3-5,7,11-15H,6H2,1-2H3;1H |
| InChIKey | IROWCYIEJAOFOW-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)C1C=CC(O)=C(O)C=1.[H]Cl |
| CAS DataBase Reference | 5984-95-2(CAS DataBase Reference) |
Description and Uses
(-)-Isoproterenol hydrochloride is a non-selective beta-adrenergic agonist. Isoproterenol is used in the treatment of bradycardia; bronchodilator.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DO1926000 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





