M4828735
Poly(antimonyethyleneglycoxide) , 97% , 29736-75-2
CAS NO.:29736-75-2
Empirical Formula: C6H12O6Sb2
Molecular Weight: 423.68
MDL number: MFCD00015879
EINECS: 249-820-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB262.40 | In Stock |
|
| 10g | RMB396.80 | In Stock |
|
| 50g | RMB913.60 | In Stock |
|
| 250g | RMB2158.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >100°C (dec.) |
| Boiling point: | 267.3℃[at 101 325 Pa] |
| Density | 1[at 20℃] |
| Flash point: | >110°C |
| Water Solubility | 400ng/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/3C2H4O2.2Sb/c3*3-1-2-4;;/h3*1-2H2;;/q3*-2;2*+3 |
| InChIKey | JEPVJCOLPSALKN-UHFFFAOYSA-N |
| SMILES | [Sb]12OCCO[Sb](OCCO1)OCCO2 |
| EPA Substance Registry System | 2,5,7,10,11,14-Hexaoxa-1,6-distibabicyclo[4.4.4]tetradecane (29736-75-2) |
Description and Uses
POLY (ANTIMONY ETHYLENE GLYCOXIDE) is an organic intermediate compound used primarily as a polyester catalyst for the preparation of polyester resin pellets and a polymer composition containing lactic acid residues.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-36/37/39 |
| TSCA | Yes |





