M4894435
2-Pivaloylamino-6-Picoline , ≥98% , 86847-79-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB201.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68 °C(Solv: hexane (110-54-3)) |
| Boiling point: | 341.0±22.0 °C(Predicted) |
| Density | 1.058±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 13.82±0.70(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C11H16N2O/c1-8-6-5-7-9(12-8)13-10(14)11(2,3)4/h5-7H,1-4H3,(H,12,13,14) |
| InChIKey | MAZMJMLUKYPLEI-UHFFFAOYSA-N |
| SMILES | C(NC1=NC(C)=CC=C1)(=O)C(C)(C)C |
Description and Uses
2-Pivaloylamino-6-Picoline is a useful reactant and reagent for the synthesis of different compounds and metal complexes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933399990 |
