M5002535
Propyleneglycolbutylether , 99.5%, the heterogeneous mixture , 29387-86-8
Synonym(s):
DOWANOL PnB
CAS NO.:29387-86-8
Empirical Formula: C7H16O2
Molecular Weight: 132.201
MDL number: MFCD01781688
EINECS: 249-598-7
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB71.20 | In Stock |
|
| 500ml | RMB182.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -15.45°C (estimate) |
| Boiling point: | 165-175 °C(lit.) |
| Density | 0.885 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 138 °F |
| InChI | InChI=1S/C7H16O2/c1-3-4-5-9-6-7(2)8/h7-8H,3-6H2,1-2H3 |
| InChIKey | RWNUSVWFHDHRCJ-UHFFFAOYSA-N |
| SMILES | C(OCCCC)C(O)C |
| CAS DataBase Reference | 29387-86-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butoxy-1-propanol(29387-86-8) |
| EPA Substance Registry System | Propylene glycol monobutyl ether (29387-86-8) |
Description and Uses
Dowanol(tM) pnb is a green and environmentally friendly high-grade solvent, which is widely used in cleaning agents, inks, leather, etc., and is one of the main components of brake fluid. It can also be used in colorful paints, photosensitive adhesives, PS plate cleaning, printing, electronic chemicals, jet engine fuel additives (water repellent), extractants and high boiling point solvents, etc.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 24/25 |
| RIDADR | UN 3271 3/PG 3 |
| WGK Germany | 1 |
| RTECS | UA7700000 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29094990 |
| Toxicity | rat,LC,inhalation,> 651ppm/4H (651ppm),National Technical Information Service. Vol. OTS0520753, |







