M5034135
Prinaberel , ≥98% , 524684-52-4
Synonym(s):
2-(3-Fluoro-4-hydroxyphenyl)-7-vinyl-1,3-benzoxazol-5-ol;Prinaberel;WAY-202041
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1063.20 | In Stock |
|
| 50mg | RMB4058.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250-252 ºC |
| Boiling point: | 451.6±45.0 °C(Predicted) |
| Density | 1.413 |
| storage temp. | room temp |
| solubility | DMSO: ≥25mg/mL |
| form | powder |
| pka | 7.50±0.20(Predicted) |
| color | white to tan |
| InChI | 1S/C15H10FNO3/c1-2-8-5-10(18)7-12-14(8)20-15(17-12)9-3-4-13(19)11(16)6-9/h2-7,18-19H,1H2 |
| InChIKey | MQIMZDXIAHJKQP-UHFFFAOYSA-N |
| SMILES | OC(C=C1)=C(F)C=C1C2=NC3=CC(O)=CC(C=C)=C3O2 |
Description and Uses
Prinaberel is a potent ERβ agonist; displays >200-fold selectivity for ERβ over ERα (IC50 values are 5 and 1216 nM for human ERβ and ERα; 3.1 and 620 nM for rat ERβ and ERα; and 3.7 and 750 nM for mouse ERβ and ERα respectively).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
