M5069248
(R)-8-(Benzyloxy)-5-(2-((5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino)-1-hydroxyethyl)quinolin-2(1H)-one , 97% , 435273-75-9
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB774.40 | In Stock |
|
| 250mg | RMB2200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-82°C |
| Boiling point: | 734.1±60.0 °C(Predicted) |
| Density | 1.23 |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.86±0.70(Predicted) |
| color | Off-White to Pale Yellow |
| InChIKey | OTINTMLHLKCOBW-NDEPHWFRSA-N |
| SMILES | N1C2=C(C([C@@H](O)CNC3CC4=C(C3)C=C(CC)C(CC)=C4)=CC=C2OCC2=CC=CC=C2)C=CC1=O |
Description and Uses
5-[(1R)-2-[(5,6-Diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-8-(phenylmethoxy)-2(1H)-quinolinone is used as a reactant in the preparation of Indacaterol (I499745), a β-adrenoreceptor agonist.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H302+H312+H332-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |






![2-Butyl-1,6-dihydro-N,N,4-trimethyl-6-oxo-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-5-pyrimidineacetamide](https://img.chemicalbook.com/CAS/20180906/GIF/503155-67-7.gif)