M5106535
Perfluoro-2-methyl-2-pentene , 98% , 1584-03-8
CAS NO.：1584-03-8
Empirical Formula: C6F12
Molecular Weight: 300.05
MDL number: MFCD00015724
EINECS: 216-436-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB388.80 | In Stock |
|
| 25g | RMB1440.00 | In Stock |
|
| 100g | RMB3984.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-50 °C |
| Boiling point: | 53-61 °C(lit.) |
| Density | 1.622 g/mL at 25 °C(lit.) |
| vapor pressure | 4.31 psi ( 20 °C) |
| Flash point: | 10 °F |
| refractive index | ca. 1.3 |
| storage temp. | Flammables area |
| form | Liquid |
| Specific Gravity | 1.62 |
| color | Clear colorless to light yellow |
| Water Solubility | insoluble |
| InChI | InChI=1S/C6F12/c7-2(3(8,9)6(16,17)18)1(4(10,11)12)5(13,14)15 |
| InChIKey | FAEGGADNHFKDQX-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)/C(/C(F)(F)F)=C(\F)/C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 1584-03-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Perfluoro-2-methyl-2-pentene(1584-03-8) |
| EPA Substance Registry System | Perfluoro(2-methylpent-2-ene) (1584-03-8) |
Description and Uses
Hexafluoropropene Dimer is used in the production of waterproof and oilproof Si/F-modified polyurethane finishing agent for textile and leather. Hexafluoropropene Dimer is also used as a blowing agent for manufacture of polyurethane foams.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H225 |
| Precautionary statements | P210-P240-P241-P280a-P303+P361+P353-P501a |
| Hazard Codes | F,Xi |
| Risk Statements | 11 |
| Safety Statements | 16-29-33 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29033990 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
