PRODUCT Properties
| Boiling point: | 100.5-103.5℃ |
| Density | 1.807±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen, away from moisture |
| form | liquid |
| color | Clear, colourless |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C4ClF9O2S/c5-17(15,16)4(13,14)2(8,9)1(6,7)3(10,11)12 |
| InChIKey | IRFCLLARAUQTNK-UHFFFAOYSA-N |
| SMILES | C(F)(F)(S(Cl)(=O)=O)C(F)(F)C(F)(F)C(F)(F)F |
| EPA Substance Registry System | Perfluoro-1-butanesulfonyl chloride (2991-84-6) |
Description and Uses
Nonafluoro-1-butanesulfonyl chloride is a raw chemical that can be used as a reagent for organic synthesis or fluorescent labelling of nucleophilic reagents.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904990090 |
