M5114135
PHENAZINEETHOSULFATE , 99% , 10510-77-7
Synonym(s):
N-Ethyldibenzopyrazine ethyl sulfate salt
CAS NO.：10510-77-7
Empirical Formula: C16H18N2O4S
Molecular Weight: 334.39
MDL number: MFCD00050286
EINECS: 234-044-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB224.00 | In Stock |
|
| 1g | RMB700.00 | In Stock |
|
| 5g | RMB2928.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C |
| storage temp. | Store at -20 |
| solubility | Aqueous Acid (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | Orange to Dark Orange |
| Stability: | Light Sensitive |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H13N2.C2H6O4S/c1-2-16-13-9-5-3-7-11(13)15-12-8-4-6-10-14(12)16;1-2-6-7(3,4)5/h3-10H,2H2,1H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | VDJKJPMLWJWQIH-UHFFFAOYSA-M |
| SMILES | CCOS([O-])(=O)=O.CC[n+]1c2ccccc2nc3ccccc13 |
| EPA Substance Registry System | Phenazinium, 5-ethyl-, ethyl sulfate (10510-77-7) |
Description and Uses
Phenazine Ethosulfate is an intermediate which is used to detect nitric oxide reducatase activity. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | SG1635000 |
| TSCA | TSCA listed |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
