PRODUCT Properties
Melting point: | 171-175 °C(lit.) |
Boiling point: | 694.7±55.0 °C(Predicted) |
Density | 1.547±0.06 g/cm3(Predicted) |
storage temp. | Store at -20°C |
solubility | Soluble in DMSO |
pka | 2.81±0.10(Predicted) |
form | Solid |
color | White to off-white |
InChI | InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25) |
InChIKey | DOUMFZQKYFQNTF-UHFFFAOYSA-N |
SMILES | C(C1C=CC(=C(C=1)O)O)C(C(=O)O)OC(=O)C=CC1C=CC(=C(C=1)O)O |
Description and Uses
antiinflammatory, antithrombotic, antiplatelet, cytostatic, antiviral
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H302-H315-H319-H335 |
Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
Hazard Codes | Xi |
Risk Statements | 36/38 |
Safety Statements | 26-37/39 |
WGK Germany | 3 |
RTECS | GD8990000 |
F | 10-23 |
Hazardous Substances Data | 537-15-5(Hazardous Substances Data) |