M5247935
Rhaponiticin , ≥98%(HPLC) , 155-58-8
Synonym(s):
3,3′,5-Trihydroxy-4′-methoxystilbene 3-O-β-D -glucoside;NSC 43321;Rhaponticin;Rhapontin
CAS NO.:155-58-8
Empirical Formula: C21H24O9
Molecular Weight: 420.41
MDL number: MFCD00010117
EINECS: 205-845-0
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB372.00 | In Stock |
|
| 20mg | RMB891.20 | In Stock |
|
| 100mg | RMB2880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236-240 °C |
| alpha | D32 -59.5° (acetone) |
| Boiling point: | 457.61°C (rough estimate) |
| Density | 1.2828 (rough estimate) |
| refractive index | 1.6230 (estimate) |
| storage temp. | 2-8°C |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 9.16±0.10(Predicted) |
| form | Solid |
| color | Brown |
| Water Solubility | slightly soluble in water |
| Merck | 13,8258 |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChI | 1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | GKAJCVFOJGXVIA-DXKBKAGUSA-N |
| SMILES | COc1ccc(\C=C\c2cc(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1O |
| LogP | 0.680 (est) |
Description and Uses
Rhapontin is a stilbene derivative found in Rheum. It is an inhibitor of Tyrosinase which is responsible for the molting process in insects, undesirable browning of fruits and vegetables, and coloring of skin, hair, and eyes in animals.
Safety
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 24/25-37/39-26 |
| WGK Germany | 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |






