PRODUCT Properties
| Boiling point: | 95-97 °C11 mm Hg(lit.) |
| Density | 0.993 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 85 °C |
| storage temp. | 2-8°C |
| pka | 15.24±0.20(Predicted) |
| optical activity | [α]20/D 41±1°, c = 5.3% in benzene |
| BRN | 3195620 |
| InChI | InChI=1/C9H12O/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3/t8-/s3 |
| InChIKey | WYTRYIUQUDTGSX-SBYBRXNCNA-N |
| SMILES | C1(C[C@H](O)C)=CC=CC=C1 |&1:2,r| |
| CAS DataBase Reference | 1572-95-8(CAS DataBase Reference) |
Description and Uses
(R)-1-Phenyl-2-propanol is a chiral alcohol. It can be widely used as a starting material as well as in asymmetric synthesis of drugs and intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P403+P235-P501 |
| Hazard Codes | Xi |
| Safety Statements | 23-24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2906290090 |
