BD3625745
2,3-Dihydro-1H-inden-2-ol , 98% , 4254-29-9
Synonym(s):
2-Hydroxyindan
CAS NO.:4254-29-9
Empirical Formula: C9H10O
Molecular Weight: 134.18
MDL number: MFCD00003800
EINECS: 224-230-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB38.40 | In Stock |
|
| 25g | RMB120.00 | In Stock |
|
| 100g | RMB434.40 | In Stock |
|
| 500g | RMB2171.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-71 °C (lit.) |
| Boiling point: | 120-123 °C (12.0016 mmHg) |
| Density | 0.8540 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| Flash point: | 109 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystaline |
| pka | 15.17±0.20(Predicted) |
| color | White to Light yellow |
| Water Solubility | 6 g/L (20 ºC) |
| BRN | 1862567 |
| InChI | InChI=1S/C9H10O/c10-9-5-7-3-1-2-4-8(7)6-9/h1-4,9-10H,5-6H2 |
| InChIKey | KMGCKSAIIHOKCX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)CC1O |
| CAS DataBase Reference | 4254-29-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Indanol(4254-29-9) |
Description and Uses
2-Indanamine metabolite.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H319 |
| Precautionary statements | P280i-P301+P310a-P305+P351+P338-P321-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22-36 |
| Safety Statements | 37/39-26-36/37/39-27-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |






