PRODUCT Properties
| Melting point: | 194-195°C |
| Boiling point: | 1064.4±65.0 °C(Predicted) |
| Density | 1.74±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in hot water |
| form | powder |
| pka | 5.81±0.40(Predicted) |
| color | light yellow crystal. hydrate: light yellow needles. |
| Water Solubility | soluble in hot water. |
| Major Application | food and beverages |
| InChIKey | PEFASEPMJYRQBW-HKWQTAEVSA-N |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2O[C@@H](OC3=C(Oc4cc(O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)cc(O)c4C3=O)c6ccc(O)cc6)[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| LogP | 0.890 (est) |
| CAS DataBase Reference | 301-19-9 |
Description and Uses
food and beverages
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







