M5411947
2,2-dioctyl-1,3,2-dioxastannepine-4,7-dione , 98% , 16091-18-2
CAS NO.:16091-18-2
Empirical Formula: C20H36O4Sn
Molecular Weight: 459.21
MDL number: MFCD00040922
EINECS: 240-253-6
| Pack Size | Price | Stock | Quantity |
| 25g | RMB496.00 | In Stock |
|
| 100g | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-105°C |
| Boiling point: | 442.6±28.0 °C(Predicted) |
| Specific Gravity | 1.37 |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| Hydrolytic Sensitivity | 2: reacts with aqueous acid |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/2C8H17.C4H4O4.Sn/c2*1-3-5-7-8-6-4-2;5-3(6)1-2-4(7)8;/h2*1,3-8H2,2H3;1-2H,(H,5,6)(H,7,8);/q;;;+2/p-2/b;;2-1-; |
| InChIKey | PZGVVCOOWYSSGB-KWZUVTIDSA-L |
| SMILES | CCCCCCCC[Sn]1(CCCCCCCC)OC(=O)C=CC(=O)O1 |
| CAS DataBase Reference | 16091-18-2(CAS DataBase Reference) |
| EPA Substance Registry System | Dioctyltin maleate (16091-18-2) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | 36/38-48/22-53-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3288 |
| WGK Germany | 3 |
| RTECS | JH4745000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 oral in rat: 4500mg/kg |




