M5436535
Sodiumlevulinate , 19856-23-6
CAS NO.：19856-23-6
Empirical Formula: C5H7NaO3
Molecular Weight: 138.097
MDL number:
EINECS: 243-378-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB224.00 | In Stock |
|
| 25g | RMB420.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.48[at 20℃] |
| vapor pressure | 0.018Pa at 135℃ |
| Water Solubility | 797.2g/L at 20℃ |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS |
| InChI | InChI=1S/C5H8O3.Na.H/c1-4(6)2-3-5(7)8;;/h2-3H2,1H3,(H,7,8);; |
| InChIKey | OFUZONQPTNWMNH-UHFFFAOYSA-N |
| SMILES | C(C(=O)C)CC(=O)O.[NaH] |
| LogP | -0.616 at 20℃ |
Description and Uses
Sodium Levulinate is the sodium salt of Levulinic Acid.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P280-P305+P351+P338-P310 |
