M5511835
SulforhodamineBacidchloride , 95% , 62796-29-6
Synonym(s):
Lissamine rhodamine B sulfonylchloride
CAS NO.：62796-29-6
Empirical Formula: C27H29ClN2O6S2
Molecular Weight: 577.11
MDL number: MFCD00042001
EINECS: 263-735-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB2736.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.1576 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| storage temp. | −20°C |
| form | powder |
| color | black |
| BRN | 7734927 |
| InChI | 1S/C27H29ClN2O6S2/c1-5-29(6-2)18-9-12-21-24(15-18)36-25-16-19(30(7-3)8-4)10-13-22(25)27(21)23-14-11-20(37(28,31)32)17-26(23)38(33,34)35/h9-17H,5-8H2,1-4H3 |
| InChIKey | YERWMQJEYUIJBO-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2c(OC3=C\C(C=CC3=C2c4ccc(cc4S([O-])(=O)=O)S(Cl)(=O)=O)=[N+](/CC)CC)c1 |
| CAS DataBase Reference | 62796-29-6 |
| EPA Substance Registry System | Xanthylium, 9-[4-(chlorosulfonyl)-2-sulfophenyl]-3,6-bis(diethylamino)-, inner salt (62796-29-6) |
Description and Uses
Sulforhodamine B acid chloride has been used to synthesize rhodamine-labeled polycation (PLL-ROD). It has also been used in fluorescent protein tracer preparation.', 'Fluorescent protein label forming stable conjugates
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10 |
| TSCA | TSCA listed |
| HS Code | 32041300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
