M6082835
Terephthalic-d4acid , 98atom%D , 60088-54-2
Synonym(s):
1,4-Benzene-d4-dicarboxylic acid
CAS NO.:60088-54-2
Empirical Formula: C8H2D4O4
Molecular Weight: 170.16
MDL number: MFCD00002559
EINECS: 262-050-1
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB142.40 | In Stock |
|
| 250mg | RMB568.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Room Temperature |
| solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 3.51(at 25℃) |
| form | Powder or Needles |
| color | White to off-white |
| InChI | 1S/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12)/i1D,2D,3D,4D |
| InChIKey | KKEYFWRCBNTPAC-RHQRLBAQSA-N |
| SMILES | [2H]c1c([2H])c(c([2H])c([2H])c1C(O)=O)C(O)=O |
| CAS Number Unlabeled | 100-21-0 |
Description and Uses
Isotope labelled Terephthalic acid is a benzenepolycarboxylic acid with potential anti-hemorrhagic properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 28459010 |
| Storage Class | 11 - Combustible Solids |






