M7019248
Kaempferol7-O-β-D-glucopyranoside , HPLC≥98% , 16290-07-6
Synonym(s):
7-(β-D -Glucopyranosyloxy)-3,5-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;Kaempferol 7-O-glucoside;Populnin
CAS NO.：16290-07-6
Empirical Formula: C21H20O11
Molecular Weight: 448.38
MDL number: MFCD08459623
EINECS: 300-006-1
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1142.40 | In Stock |
|
| 5mg | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 269-271℃ |
| Boiling point: | 810.2±65.0 °C(Predicted) |
| Density | 1.736 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO: soluble |
| form | A solid |
| pka | 5.94±0.40(Predicted) |
| color | Light yellow to yellow |
| BRN | 68205 |
| InChIKey | YPWHZCPMOQGCDQ-FJOWETSVNA-N |
| SMILES | C1(O)=C(C2=CC=C(C=C2)O)OC2C=C(C=C(O)C=2C1=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |&1:21,23,26,28,30,r| |
| LogP | -0.190 (est) |
Description and Uses
Kaempferol-7-O-β-D-glucoside can be used for its antioxidant and anti-inflammatory activities.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H304 |
| Precautionary statements | P501-P331-P301+P310-P405 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29389090 |
