M7031248
5-(2-Nitrophenyl)furan-2-carbaldehyde , 95% , 20000-96-8
Synonym(s):
5-(2-Nitrophenyl)-2-furancarboxaldehyde
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB180.80 | In Stock |
|
| 1g | RMB534.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-97 °C(lit.) |
| Boiling point: | 105-107 °C30 mm Hg(lit.) |
| Density | 1.3654 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| form | solid |
| InChI | 1S/C11H7NO4/c13-7-8-5-6-11(16-8)9-3-1-2-4-10(9)12(14)15/h1-7H |
| InChIKey | QBYRUURYXPVDAK-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(o1)-c2ccccc2[N+]([O-])=O |
| CAS DataBase Reference | 20000-96-8(CAS DataBase Reference) |
Description and Uses
5-(2-Nitrophenyl)furfural (5-(2-nitrophenyl)-2-furfuraldehyde) was used in the synthesis of (5-(2-nitrophenyl)furfuran-2-yl)methanol.
It may be used in the synthesis of 2-{[5-(2-nitrophenyl)furan-2-yl]methyleneamino}benzoic acid (HOBZ) by reacting with 2-aminobenzoic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






