M7037048
5-(4-Methoxyphenyl)furan-2-carbaldehyde , 95% , 34070-33-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB774.40 | In Stock |
|
| 1g | RMB1777.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-42.5℃ |
| Boiling point: | 166 °C(Press: 1 Torr) |
| Density | 1.167±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Heated), Chloroform, Methanol (Slightly) |
| form | Orange to Dark Red Semi-Solid |
| InChI | 1S/C12H10O3/c1-14-10-4-2-9(3-5-10)12-7-6-11(8-13)15-12/h2-8H,1H3 |
| InChIKey | JPCUGGGXLKGQEP-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)-c2ccc(C=O)o2 |
Description and Uses
5-(4-Methoxyphenyl)-2-furancarboxaldehyde is an intermediate in the synthesis of near-IR fluorescent dyes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





