PRODUCT Properties
| Melting point: | >360° (dec) |
| alpha | D23 +206° (c = 1.012 in chloroform) |
| Boiling point: | 512.66°C (rough estimate) |
| Density | 1.1922 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | −20°C |
| solubility | Dichloromethane: soluble,DMSO: soluble,Ethanol: soluble,Methanol: soluble |
| form | A solid |
| pka | 12.76±0.70(Predicted) |
| color | White to light yellow |
| InChIKey | NLUGUZJQJYVUHS-YDFGWWAZSA-N |
| SMILES | CC1CCOC(=O)\C=C\C=C\C(=O)OC2CC3OC4C=C(C)CCC4(COC(=O)C1O)C2(C)C35CO5 |
Description and Uses
Verrucarin A from Myrothecium sp has been used:
- as a translation initiation inhibitor in P. falciparum W2 strain
- as a peptidyl transfer inhibitor to test sensitivity in methyltransferase knock-out S. cerevisiae cells
- to test its cytotoxicity in renal cell carcinoma cells
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | WH1314900 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 2941900000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral |
| Toxicity | LD50 in mice, rats, rabbits (mg/kg): 1.5, 0.87, 0.54 i.v. (Rüsch, Sthlin) |





